ChemIndex - Basis data CAS kimia gratisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
6,7-Bis (benziloksi) kumarin |
|
Nama produk | 6,7-Bis (benziloksi) kumarin |
Sinonim | ; Esculetin dibenzyl ether; 6,7-bis (benziloksi) -2H-chromen-2-satu; |
Nama bahasa Inggris | 6,7-Bis(benzyloxy)coumarin;Esculetin dibenzyl ether;6,7-bis(benzyloxy)-2H-chromen-2-one |
MF | C23H18O4 |
Berat Molekul | 358.3866 |
InChI | InChI=1/C23H18O4/c24-23-12-11-19-13-21(25-15-17-7-3-1-4-8-17)22(14-20(19)27-23)26-16-18-9-5-2-6-10-18/h1-14H,15-16H2 |
CAS NO | 909-84-2 |
EINECS | 213-003-9 |
Struktur Molekul | |
Kepadatan | 1.25g/cm3 |
Titik didih | 560.2°C at 760 mmHg |
Indeks bias | 1.631 |
Titik nyala | 246°C |
Tekanan uap | 1.4E-12mmHg at 25°C |
Keselamatan Deskripsi | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |