ChemIndex - Basis data CAS kimia gratisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,5-Bis(1-naphthyl)-1,3,4-oxadiazole |
|
Nama produk | 2,5-Bis(1-naphthyl)-1,3,4-oxadiazole |
Nama bahasa Inggris | 2,5-Bis(1-naphthyl)-1,3,4-oxadiazole;2,5-Di(1-naphthyl)-1,3,4-oxadiazole;2,5-di(naphthalen-1-yl)-1,3,4-oxadiazole |
MF | C22H14N2O |
Berat Molekul | 322.3594 |
InChI | InChI=1/C22H14N2O/c1-3-11-17-15(7-1)9-5-13-19(17)21-23-24-22(25-21)20-14-6-10-16-8-2-4-12-18(16)20/h1-14H |
CAS NO | 905-62-4 |
EINECS | 212-995-0 |
Struktur Molekul | |
Kepadatan | 1.251g/cm3 |
Titik didih | 556.4°C at 760 mmHg |
Indeks bias | 1.7 |
Titik nyala | 293.1°C |
Tekanan uap | 7.55E-12mmHg at 25°C |
Keselamatan Deskripsi | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |