ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-79-2 Isopulegol |
|
Nama produk | Isopulegol |
Sinonim | ; 1-Metil-4-isopropenylcyclohexan-3-ol; p-menth-8-en-3-ol; (1R,2S,5R)-5-metil-2-(prop-1-en-2-yl)sikloheksanol; |
Nama bahasa Inggris | Isopulegol;1-Methyl-4-isopropenylcyclohexan-3-ol;p-menth-8-en-3-ol;(1R,2S,5R)-5-methyl-2-(prop-1-en-2-yl)cyclohexanol |
MF | C10H18O |
Berat Molekul | 154.2493 |
InChI | InChI=1/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h8-11H,1,4-6H2,2-3H3/t8-,9+,10-/m1/s1 |
CAS NO | 89-79-2 |
EINECS | 201-940-6 |
Struktur Molekul | |
Kepadatan | 0.912g/cm3 |
Titik didih | 197°C at 760 mmHg |
Indeks bias | 1.472 |
Titik nyala | 78.3°C |
Tekanan uap | 0.0993mmHg at 25°C |
Simbol bahaya | Xn##Harmful:; |
Kode Risiko | R21/22##Harmful in contact with skin and if swallowed.:; |
MSDS |