ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88634-80-4 2-ethyl-4-methyl-1H-imidazole-5-carbaldehyde |
|
Nama produk | 2-ethyl-4-methyl-1H-imidazole-5-carbaldehyde |
Nama bahasa Inggris | 2-ethyl-4-methyl-1H-imidazole-5-carbaldehyde;2-ethyl-5-methyl-1H-imidazole-4-carbaldehyde |
MF | C7H10N2O |
Berat Molekul | 138.1671 |
InChI | InChI=1/C7H10N2O/c1-3-7-8-5(2)6(4-10)9-7/h4H,3H2,1-2H3,(H,8,9) |
CAS NO | 88634-80-4 |
Struktur Molekul | |
Kepadatan | 1.134g/cm3 |
Titik lebur | 104℃ |
Titik didih | 360.8°C at 760 mmHg |
Indeks bias | 1.569 |
Titik nyala | 175.8°C |
Tekanan uap | 2.16E-05mmHg at 25°C |
Simbol bahaya | Xi##Irritant:; |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |