ChemIndex - Basis data CAS kimia gratisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,4'-Dichlorobenzophenone |
|
Nama produk | 2,4'-Dichlorobenzophenone |
Nama bahasa Inggris | 2,4'-Dichlorobenzophenone;Dichlorobenzophenone |
MF | C13H8Cl2O |
Berat Molekul | 251.11 |
InChI | InChI=1/C13H8Cl2O/c14-10-7-5-9(6-8-10)13(16)11-3-1-2-4-12(11)15/h1-8H |
CAS NO | 85-29-0 |
EINECS | 201-596-7 |
Struktur Molekul | |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |