Chemindex > 825-03-6
ID ▼
825-03-6 2-Methylbicyclo[2.2.1]-5-heptene-2-carboxylic Acid |
|
| Nama produk | 2-Methylbicyclo[2.2.1]-5-heptene-2-carboxylic Acid |
| Nama bahasa Inggris | 2-Methylbicyclo[2.2.1]-5-heptene-2-carboxylic Acid;2-Methylbicyclo[2.2.1]hept-5-ene-2-carboxylic acid;5-Methyl-2-norbornene-5-carboxylic Acid;(1S,2S,4R)-2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate;(1S,2R,4R)-2-methylbicyclo[2.2.1]hept-5-ene-2-carboxylate |
| MF | C9H11O2 |
| Berat Molekul | 151.183 |
| InChI | InChI=1/C9H12O2/c1-9(8(10)11)5-6-2-3-7(9)4-6/h2-3,6-7H,4-5H2,1H3,(H,10,11)/p-1/t6-,7-,9-/m1/s1 |
| CAS NO | 825-03-6 |
| Struktur Molekul | ![825-03-6 2-Methylbicyclo[2.2.1]-5-heptene-2-carboxylic Acid](https://images-a.chemnet.com/suppliers/chembase/468/46854.gif "825-03-6 2-Methylbicyclo[2.2.1]-5-heptene-2-carboxylic Acid") |
| Titik lebur | 83℃ |
| Titik didih | 261.352°C at 760 mmHg |
| Titik nyala | 121.096°C |
| Tekanan uap | 0.003mmHg at 25°C |
| Simbol bahaya |  Xi##Irritant:; |
| Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |
- Jika Anda berencana untuk mendapatkan bahan kimia dari China, pergi saja ke mal ChemNet, kami akan mendapatkan harga terbaru dan kompetitif dari produsen China untuk Anda.Silakan kunjungi
ChemNet Mall
Layanan Database CAS Kimia disediakan oleh ChemIndex.com 