ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
823-76-7 Cyclohexyl methyl ketone |
|
Nama produk | Cyclohexyl methyl ketone |
Nama bahasa Inggris | Cyclohexyl methyl ketone;Acetylcyclohexane~Hexahydroacetophenone~Methyl cyclohexyl ketone;Acetylcyclohexane;1-cyclohexylethanone;1-CYCLOHEXYLETHAN-1-ONE |
MF | C8H14O |
Berat Molekul | 126.1962 |
InChI | InChI=1/C8H14O/c1-7(9)8-5-3-2-4-6-8/h8H,2-6H2,1H3 |
CAS NO | 823-76-7 |
EINECS | 212-517-0 |
Struktur Molekul | |
Kepadatan | 0.916g/cm3 |
Titik didih | 181.5°C at 760 mmHg |
Indeks bias | 1.448 |
Titik nyala | 61.4°C |
Tekanan uap | 0.849mmHg at 25°C |
Kode Risiko | R36/38##Irritating to eyes and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |