ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
813-56-9 Malonat-d2 asam-d2 |
|
Nama produk | Malonat-d2 asam-d2 |
Sinonim | ; Asam malonat-d4; (~ 2 ~ H_2_) propana (~ 2 ~ H_2_) asam dioat; |
Nama bahasa Inggris | Malonic-d2 acid-d2;Malonic acid-d4;(~2~H_2_)propane(~2~H_2_)dioic acid |
MF | C3D4O4 |
Berat Molekul | 108.0861 |
InChI | InChI=1/C3H4O4/c4-2(5)1-3(6)7/h1H2,(H,4,5)(H,6,7)/i1D2/hD2 |
CAS NO | 813-56-9 |
EINECS | 212-385-4 |
Struktur Molekul | |
Kepadatan | 1.605g/cm3 |
Titik lebur | 130-132℃ |
Titik didih | 386.8°C at 760 mmHg |
Indeks bias | 1.478 |
Titik nyala | 201.9°C |
Tekanan uap | 4.66E-07mmHg at 25°C |
Simbol bahaya | Xn##Harmful:; |
Kode Risiko | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |