ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
80548-31-8 (R)-( )-N-(2-hidroksietil)-alfa-feniletillamina |
|
Nama produk | (R)-( )-N-(2-hidroksietil)-alfa-feniletillamina |
Sinonim | ;(R)-( )-2-(1-Phenylethyl)-amino-etanol; (R)-( )-N-(2-hidroksietil)-alfa-metilbenzilamin; (R)-( )-2-[(1-Phenylethyl)-amino]-etanol; (1R)-N-(2-hidroksietil)-1-feniletaniminium; 2-{[(1R)-1-feniletil]amino}etanol; |
Nama bahasa Inggris | (R)-(+)-N-(2-Hydroxyethyl)-alpha-phenylethylamine;(R)-(+)-2-(1-Phenylethyl)-amino-ethanol;(R)-(+)-N-(2-Hydroxyethyl)-alpha-methylbenzylamine;(R)-(+)-2-[(1-Phenylethyl)-amino]-ethanol;(1R)-N-(2-hydroxyethyl)-1-phenylethanaminium;2-{[(1R)-1-phenylethyl]amino}ethanol |
MF | C10H15NO |
Berat Molekul | 165.2322 |
InChI | InChI=1/C10H15NO/c1-9(11-7-8-12)10-5-3-2-4-6-10/h2-6,9,11-12H,7-8H2,1H3/t9-/m1/s1 |
CAS NO | 80548-31-8 |
Struktur Molekul | |
Kepadatan | 1.017g/cm3 |
Titik didih | 285.7°C at 760 mmHg |
Indeks bias | 1.53 |
Titik nyala | 114.4°C |
Tekanan uap | 0.00129mmHg at 25°C |
Simbol bahaya | Xi##Irritant:; |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |