ChemIndex - Basis data CAS kimia gratisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene |
|
Nama produk | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene |
Nama bahasa Inggris | 2,2-Bis(4-chlorophenyl)-1,1-dichloroethylene;p,p-DDE |
MF | C14H8Cl4 |
Berat Molekul | 318.02 |
InChI | InChI=1/C14H8Cl4/c15-11-5-1-9(2-6-11)13(14(17)18)10-3-7-12(16)8-4-10/h1-8H |
CAS NO | 72-55-9 |
EINECS | 200-784-6 |
Struktur Molekul | |
Titik lebur | 87-90℃ |
Kelarutan air | 0.00000013 g/100 mL |
Simbol bahaya | Xn##Harmful:; |
Kode Risiko | R22##Harmful if swallowed.||R33##Danger of cummulative effects.:; |
Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
MSDS |