ChemIndex - Basis data CAS kimia gratisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
9-chloroanthracene |
|
Nama produk | 9-chloroanthracene |
Nama bahasa Inggris | 9-chloroanthracene;Anthracene, 9-chloro-;9-Chloroanthracene;CCRIS 5547 |
MF | C14H9Cl |
Berat Molekul | 212.6743 |
InChI | InChI=1/C14H9Cl/c15-14-12-7-3-1-5-10(12)9-11-6-2-4-8-13(11)14/h1-9H |
CAS NO | 716-53-0 |
EINECS | 211-937-1 |
Struktur Molekul | |
Kepadatan | 1.253g/cm3 |
Titik lebur | 103-103℃ |
Titik didih | 370.1°C at 760 mmHg |
Indeks bias | 1.717 |
Titik nyala | 179.2°C |
Tekanan uap | 2.42E-05mmHg at 25°C |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |