ChemIndex - Basis data CAS kimia gratisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Homophthalic anhydride |
|
Nama produk | Homophthalic anhydride |
Nama bahasa Inggris | Homophthalic anhydride;1,3-Isochromandione;benzoglutaric anhydride;1H-isochromene-1,3(4H)-dione;o-Carboxyphenylacetic acid cyclic anhydride~1,3-Isochromanedione |
MF | C9H6O3 |
Berat Molekul | 162.1421 |
InChI | InChI=1/C9H6O3/c10-8-5-6-3-1-2-4-7(6)9(11)12-8/h1-4H,5H2 |
CAS NO | 703-59-3 |
EINECS | 211-873-4 |
Struktur Molekul | |
Kepadatan | 1.347g/cm3 |
Titik lebur | 140-144℃ |
Titik didih | 324.5°C at 760 mmHg |
Indeks bias | 1.584 |
Titik nyala | 159°C |
Tekanan uap | 0.000244mmHg at 25°C |
Simbol bahaya | Xi##Irritant:; |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |