ChemIndex - Basis data CAS kimia gratisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
6-Methoxysalicylaldehyde |
|
Nama produk | 6-Methoxysalicylaldehyde |
Nama bahasa Inggris | 6-Methoxysalicylaldehyde;2-Hydroxy-6-methoxybenzaldehyde;6-Hydroxy-o-anisaldehyde;2-hydroxy-6-methoxy benzaldehyde |
MF | C8H8O3 |
Berat Molekul | 152.1473 |
InChI | InChI=1/C8H8O3/c1-11-8-4-2-3-7(10)6(8)5-9/h2-5,10H,1H3 |
CAS NO | 700-44-7 |
EINECS | 211-844-6 |
Struktur Molekul | |
Kepadatan | 1.231g/cm3 |
Titik didih | 262.9°C at 760 mmHg |
Indeks bias | 1.587 |
Titik nyala | 107.8°C |
Tekanan uap | 0.00651mmHg at 25°C |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |