ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
693-55-0 Ethyl hydrogen sebacate |
|
Nama produk | Ethyl hydrogen sebacate |
Nama bahasa Inggris | Ethyl hydrogen sebacate;Monoethyl sebacate~Sebacic acid monoethyl ester;monoethyl sebacate;Decanedioic acid monoethyl ester~Monoethyl sebacate~Sebacic acid monoethyl ester;10-ethoxy-10-oxodecanoic acid |
MF | C12H22O4 |
Berat Molekul | 230.3007 |
InChI | InChI=1/C12H22O4/c1-2-16-12(15)10-8-6-4-3-5-7-9-11(13)14/h2-10H2,1H3,(H,13,14) |
CAS NO | 693-55-0 |
EINECS | 211-753-1 |
Struktur Molekul | |
Kepadatan | 1.024g/cm3 |
Titik didih | 336°C at 760 mmHg |
Indeks bias | 1.455 |
Titik nyala | 119°C |
Tekanan uap | 2.17E-05mmHg at 25°C |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |