ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
68067-13-0 5-okso-L-prolin, senyawa dengan dicyclohexylamine (1:1) |
|
Nama produk | 5-okso-L-prolin, senyawa dengan dicyclohexylamine (1:1) |
Sinonim | 5-Oxo-L-prolin, senyawa dengan dicyclohexylamine (1:1); 5-okso-L-prolin - N-sikloheksilsikloheksamine (1:1); |
Nama bahasa Inggris | 5-oxo-L-proline, compound with dicyclohexylamine (1:1);5-Oxo-L-proline, compound with dicyclohexylamine (1:1);5-oxo-L-proline - N-cyclohexylcyclohexanamine (1:1) |
MF | C17H30N2O3 |
Berat Molekul | 310.4317 |
InChI | InChI=1/C12H23N.C5H7NO3/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;7-4-2-1-3(6-4)5(8)9/h11-13H,1-10H2;3H,1-2H2,(H,6,7)(H,8,9)/t;3-/m.0/s1 |
CAS NO | 68067-13-0 |
EINECS | 268-334-1 |
Struktur Molekul | |
Titik didih | 256.1°C at 760 mmHg |
Titik nyala | 96.1°C |
Tekanan uap | 0.0157mmHg at 25°C |
MSDS |