ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
66424-91-7 5-Methyl-2-nitrobenzyl chloride |
|
Nama produk | 5-Methyl-2-nitrobenzyl chloride |
Nama bahasa Inggris | 5-Methyl-2-nitrobenzyl chloride;alpha-chloro-5-methyl-2-nitrotoluene;2-(chloromethyl)-4-methyl-1-nitrobenzene |
MF | C8H8ClNO2 |
Berat Molekul | 185.6076 |
InChI | InChI=1/C8H8ClNO2/c1-6-2-3-8(10(11)12)7(4-6)5-9/h2-4H,5H2,1H3 |
CAS NO | 66424-91-7 |
EINECS | 266-359-2 |
Struktur Molekul | |
Kepadatan | 1.277g/cm3 |
Titik lebur | 41-43℃ |
Titik didih | 292.3°C at 760 mmHg |
Indeks bias | 1.566 |
Titik nyala | 130.6°C |
Tekanan uap | 0.00324mmHg at 25°C |
Simbol bahaya | C##Corrosive:; |
Kode Risiko | R34##Causes burns.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |