ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
64399-27-5 1-(4-Chlorophenyl)-1-cyclopropanecarbonitrile |
|
Nama produk | 1-(4-Chlorophenyl)-1-cyclopropanecarbonitrile |
Nama bahasa Inggris | 1-(4-Chlorophenyl)-1-cyclopropanecarbonitrile;1-(p-Chlorophenyl)cyclopropanecarbonitrile;1-(4-chlorophenyl)cyclopropanecarbonitrile |
MF | C10H8ClN |
Berat Molekul | 177.6302 |
InChI | InChI=1/C10H8ClN/c11-9-3-1-8(2-4-9)10(7-12)5-6-10/h1-4H,5-6H2 |
CAS NO | 64399-27-5 |
EINECS | 264-871-0 |
Struktur Molekul | |
Kepadatan | 1.24g/cm3 |
Titik lebur | 52-56℃ |
Titik didih | 303.1°C at 760 mmHg |
Indeks bias | 1.589 |
Titik nyala | 133.1°C |
Tekanan uap | 0.000947mmHg at 25°C |
Simbol bahaya | Xi##Irritant:; |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
MSDS |