ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
620-79-1 Ethyl 2-benzylacetoacetate |
|
Nama produk | Ethyl 2-benzylacetoacetate |
Nama bahasa Inggris | Ethyl 2-benzylacetoacetate;2-Benzylacetoacetic acid ethyl ester;ethyl 2-benzyl-3-oxobutanoate;ethyl (2S)-2-benzyl-3-oxobutanoate;ethyl (2R)-2-benzyl-3-oxobutanoate;Ethyl-2-benzylacetoacetate;Ethyl 2-acetyl-3-phenylpropionate |
MF | C13H16O3 |
Berat Molekul | 220.2643 |
InChI | InChI=1/C13H16O3/c1-3-16-13(15)12(10(2)14)9-11-7-5-4-6-8-11/h4-8,12H,3,9H2,1-2H3/t12-/m1/s1 |
CAS NO | 620-79-1 |
EINECS | 210-651-4 |
Struktur Molekul | |
Kepadatan | 1.07g/cm3 |
Titik didih | 276°C at 760 mmHg |
Indeks bias | 1.502 |
Titik nyala | 132.3°C |
Tekanan uap | 0.00493mmHg at 25°C |
Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
MSDS |