ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
617-05-0 Vanilicacidethylester; 97% |
|
Nama produk | Vanilicacidethylester; 97% |
Nama bahasa Inggris | Vanilicacidethylester; 97%;Vanilic acid ethyl ester;Ethyl vanillate;Ethyl 4-hydroxy-3-methoxybenzoate~Vanillic acid ethyl ester;4-Hydroxy-3-methoxybenzoic acid ethyl ester;ethyl 4-hydroxy-3-methoxybenzoate |
MF | C10H12O4 |
Berat Molekul | 196.1999 |
InChI | InChI=1/C10H12O4/c1-3-14-10(12)7-4-5-8(11)9(6-7)13-2/h4-6,11H,3H2,1-2H3 |
CAS NO | 617-05-0 |
EINECS | 210-503-9 |
Struktur Molekul | |
Kepadatan | 1.18g/cm3 |
Titik lebur | 39-41℃ |
Titik didih | 292°C at 760 mmHg |
Indeks bias | 1.528 |
Titik nyala | 122.4°C |
Tekanan uap | 0.00108mmHg at 25°C |
Keselamatan Deskripsi | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |