ChemIndex - Basis data CAS kimia gratisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
o-Tolyl benzoate |
|
Nama produk | o-Tolyl benzoate |
Nama bahasa Inggris | o-Tolyl benzoate;o-Tolyl benzoate (Benzoic acid o-tolyl ester);Benzoic acid o-tolyl ester;2-methylphenyl benzoate |
MF | C14H12O2 |
Berat Molekul | 212.2439 |
InChI | InChI=1/C14H12O2/c1-11-7-5-6-10-13(11)16-14(15)12-8-3-2-4-9-12/h2-10H,1H3 |
CAS NO | 617-02-7 |
EINECS | 210-501-8 |
Struktur Molekul | |
Kepadatan | 1.122g/cm3 |
Titik didih | 368.9°C at 760 mmHg |
Indeks bias | 1.577 |
Titik nyala | 154.5°C |
Tekanan uap | 1.23E-05mmHg at 25°C |
Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
MSDS |