ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
615-94-1 2,5-Dihydroxy-1,4-benzoquinone |
|
Nama produk | 2,5-Dihydroxy-1,4-benzoquinone |
Nama bahasa Inggris | 2,5-Dihydroxy-1,4-benzoquinone;2,5-Dihydroxybenzoquinone;2,5-dihydroxycyclohexa-2,5-diene-1,4-dione |
MF | C6H4O4 |
Berat Molekul | 140.0936 |
InChI | InChI=1/C6H4O4/c7-3-1-4(8)6(10)2-5(3)9/h1-2,7,10H |
CAS NO | 615-94-1 |
EINECS | 210-454-3 |
Struktur Molekul | |
Kepadatan | 1.843g/cm3 |
Titik lebur | 220℃ |
Titik didih | 322.3°C at 760 mmHg |
Indeks bias | 1.729 |
Titik nyala | 162.9°C |
Tekanan uap | 2.24E-05mmHg at 25°C |
Simbol bahaya | Xn##Harmful:; |
Kode Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Keselamatan Deskripsi | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |