ChemIndex - Basis data CAS kimia gratisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Cinnamylideneacetophenone |
|
Nama produk | Cinnamylideneacetophenone |
Nama bahasa Inggris | Cinnamylideneacetophenone;5-phenylpenta-2,4-dienophenone;1,5-Diphenyl-2,4-pentadien-1-one~5-Phenyl-2,4-pentadienophenone;1,5-diphenylpenta-2,4-dien-1-one;(2E,4E)-1,5-diphenylpenta-2,4-dien-1-one |
MF | C17H14O |
Berat Molekul | 234.2925 |
InChI | InChI=1/C17H14O/c18-17(16-12-5-2-6-13-16)14-8-7-11-15-9-3-1-4-10-15/h1-14H/b11-7+,14-8+ |
CAS NO | 614-57-3 |
EINECS | 210-385-9 |
Struktur Molekul | |
Kepadatan | 1.082g/cm3 |
Titik lebur | 100-102℃ |
Titik didih | 388.1°C at 760 mmHg |
Indeks bias | 1.624 |
Titik nyala | 169.6°C |
Tekanan uap | 3.15E-06mmHg at 25°C |
Keselamatan Deskripsi | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |