ChemIndex - Basis data CAS kimia gratisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
P-tolil benzoat |
|
Nama produk | P-tolil benzoat |
Sinonim | ;p-Tolyl benzoate (Asam benzoat p-tolyl ester); Asam benzoat p-tolyl ester; 4-metilfenil benzoat; |
Nama bahasa Inggris | P-tolyl benzoate;p-Tolyl benzoate (Benzoic acid p-tolyl ester);Benzoic acid p-tolyl ester;4-methylphenyl benzoate |
MF | C14H12O2 |
Berat Molekul | 212.2439 |
InChI | InChI=1/C14H12O2/c1-11-7-9-13(10-8-11)16-14(15)12-5-3-2-4-6-12/h2-10H,1H3 |
CAS NO | 614-34-6 |
EINECS | 210-380-1 |
Struktur Molekul | |
Kepadatan | 1.122g/cm3 |
Titik lebur | 70-72℃ |
Titik didih | 316.6°C at 760 mmHg |
Indeks bias | 1.577 |
Titik nyala | 130.1°C |
Tekanan uap | 0.000407mmHg at 25°C |
Keselamatan Deskripsi | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |