ChemIndex - Basis data CAS kimia gratisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4-(2-Methylphenyl)-3-thiosemicarbazide |
|
Nama produk | 4-(2-Methylphenyl)-3-thiosemicarbazide |
Nama bahasa Inggris | 4-(2-Methylphenyl)-3-thiosemicarbazide;4-(o-Tolyl)-3-thiosemicarbazide;N-(2-methylphenyl)hydrazinecarbothioamide;2-(2-methylphenyl)hydrazinecarbothioamide |
MF | C8H11N3S |
Berat Molekul | 181.258 |
InChI | InChI=1/C8H11N3S/c1-6-4-2-3-5-7(6)10-11-8(9)12/h2-5,10H,1H3,(H3,9,11,12) |
CAS NO | 614-10-8 |
Struktur Molekul | |
Kepadatan | 1.27g/cm3 |
Titik didih | 295.9°C at 760 mmHg |
Indeks bias | 1.699 |
Titik nyala | 132.8°C |
Tekanan uap | 0.00148mmHg at 25°C |
Kode Risiko | R25##Toxic if swallowed.:; |
Keselamatan Deskripsi | S22##Do not inhale dust.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |