ChemIndex - Basis data CAS kimia gratisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Methylanthracene |
|
Nama produk | 2-Methylanthracene |
Nama bahasa Inggris | 2-Methylanthracene;CCRIS 2739;NSC 87376;Anthracene, 2-methyl- |
MF | C15H12 |
Berat Molekul | 192.2558 |
InChI | InChI=1/C15H12/c1-11-14-8-4-2-6-12(14)10-13-7-3-5-9-15(11)13/h2-10H,1H3 |
CAS NO | 613-12-7 |
EINECS | 210-329-3 |
Struktur Molekul | |
Kepadatan | 1.105g/cm3 |
Titik lebur | 202-206℃ |
Titik didih | 347.2°C at 760 mmHg |
Indeks bias | 1.693 |
Titik nyala | 157.5°C |
Tekanan uap | 0.00011mmHg at 25°C |
Simbol bahaya | Xn##Harmful:; |
Kode Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
MSDS |