ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
611-79-0 3,3'-Diaminobenzophenone |
|
Nama produk | 3,3'-Diaminobenzophenone |
Nama bahasa Inggris | 3,3'-Diaminobenzophenone;bis(3-aminophenyl)methanone |
MF | C13H12N2O |
Berat Molekul | 212.2472 |
InChI | InChI=1/C13H12N2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H,14-15H2 |
CAS NO | 611-79-0 |
EINECS | 210-281-3 |
Struktur Molekul | |
Kepadatan | 1.233g/cm3 |
Titik didih | 469.4°C at 760 mmHg |
Indeks bias | 1.673 |
Titik nyala | 237.7°C |
Tekanan uap | 5.51E-09mmHg at 25°C |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |