ChemIndex - Basis data CAS kimia gratisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Methyl 2-nitrobenzoate |
|
Nama produk | Methyl 2-nitrobenzoate |
Nama bahasa Inggris | Methyl 2-nitrobenzoate;2-Nitrobenzoic acid methyl ester |
MF | C8H7NO4 |
Berat Molekul | 181.1455 |
InChI | InChI=1/C8H7NO4/c1-13-8(10)6-4-2-3-5-7(6)9(11)12/h2-5H,1H3 |
CAS NO | 606-27-9 |
EINECS | 210-111-8 |
Struktur Molekul | |
Kepadatan | 1.301g/cm3 |
Titik lebur | -13℃ |
Titik didih | 275°C at 760 mmHg |
Indeks bias | 1.553 |
Titik nyala | 124.8°C |
Tekanan uap | 0.00523mmHg at 25°C |
Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
MSDS |