ChemIndex - Basis data CAS kimia gratisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Nitrobenzhydrazide |
|
Nama produk | 2-Nitrobenzhydrazide |
Nama bahasa Inggris | 2-Nitrobenzhydrazide;2-Nitrobenzoic hydrazide;2-Nitrobenzoyl hydrazide;2-nitrobenzohydrazide |
MF | C7H7N3O3 |
Berat Molekul | 181.1488 |
InChI | InChI=1/C7H7N3O3/c8-9-7(11)5-3-1-2-4-6(5)10(12)13/h1-4H,8H2,(H,9,11) |
CAS NO | 606-26-8 |
EINECS | 210-110-2 |
Struktur Molekul | |
Kepadatan | 1.406g/cm3 |
Titik lebur | 123℃ |
Indeks bias | 1.621 |
Simbol bahaya | Xi##Irritant:; |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |