ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54376-65-7 4-Diethylaminobenzaldehyde oxime |
|
Nama produk | 4-Diethylaminobenzaldehyde oxime |
Nama bahasa Inggris | 4-Diethylaminobenzaldehyde oxime;4-Diethylaminobenzaldoxime |
MF | C11H16N2O |
Berat Molekul | 192.2575 |
InChI | InChI=1/C11H16N2O/c1-3-13(4-2)11-7-5-10(6-8-11)9-12-14/h5-9,14H,3-4H2,1-2H3/b12-9+ |
CAS NO | 54376-65-7 |
Struktur Molekul | |
Kepadatan | 1g/cm3 |
Titik didih | 307.7°C at 760 mmHg |
Indeks bias | 1.517 |
Titik nyala | 139.9°C |
Tekanan uap | 0.000309mmHg at 25°C |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |