ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52605-96-6 2-Chloro-3-methoxypyridine |
|
Nama produk | 2-Chloro-3-methoxypyridine |
Nama bahasa Inggris | 2-Chloro-3-methoxypyridine; |
MF | C6H6ClNO |
Berat Molekul | 143.5709 |
InChI | InChI=1/C6H6ClNO/c1-9-5-3-2-4-8-6(5)7/h2-4H,1H3 |
CAS NO | 52605-96-6 |
EINECS | 258-039-6 |
Struktur Molekul | |
Kepadatan | 1.21g/cm3 |
Titik didih | 210.6°C at 760 mmHg |
Indeks bias | 1.517 |
Titik nyala | 81.2°C |
Tekanan uap | 0.276mmHg at 25°C |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |