ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52547-00-9 5-Amino-3-methylisothiazole hydrochloride |
|
Nama produk | 5-Amino-3-methylisothiazole hydrochloride |
Nama bahasa Inggris | 5-Amino-3-methylisothiazole hydrochloride;5-Amino-3-methyl-isothiazole hydrochloride;3-methylisothiazol-5-ylamine hydrochloride;3-methyl-1,2-thiazol-5-aminium chloride |
MF | C4H7ClN2S |
Berat Molekul | 150.6298 |
InChI | InChI=1/C4H6N2S.ClH/c1-3-2-4(5)7-6-3;/h2H,5H2,1H3;1H |
CAS NO | 52547-00-9 |
EINECS | 257-997-2 |
Struktur Molekul | |
Titik lebur | 300℃ |
Titik didih | 120.7°C at 760 mmHg |
Titik nyala | 26.8°C |
Tekanan uap | 15mmHg at 25°C |
Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
MSDS |