ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52085-14-0 4-Benzyloxy-2-hydroxybenzaldehyde |
|
Nama produk | 4-Benzyloxy-2-hydroxybenzaldehyde |
Nama bahasa Inggris | 4-Benzyloxy-2-hydroxybenzaldehyde;4-Benzyloxysalicylaldehyde;4-(benzyloxy)-2-hydroxybenzaldehyde |
MF | C14H12O3 |
Berat Molekul | 228.2433 |
InChI | InChI=1/C14H12O3/c15-9-12-6-7-13(8-14(12)16)17-10-11-4-2-1-3-5-11/h1-9,16H,10H2 |
CAS NO | 52085-14-0 |
Struktur Molekul | |
Kepadatan | 1.238g/cm3 |
Titik didih | 390.9°C at 760 mmHg |
Indeks bias | 1.636 |
Titik nyala | 149.9°C |
Tekanan uap | 1.14E-06mmHg at 25°C |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |