ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
519-05-1 2-Carboxy-3,4-dimethoxybenzaldehyde |
|
Nama produk | 2-Carboxy-3,4-dimethoxybenzaldehyde |
Nama bahasa Inggris | 2-Carboxy-3,4-dimethoxybenzaldehyde;5,6-Dimethoxyphthalaldehydic acid~6-Formyl-2,3-dimethoxybenzoic acid~Opianic acid;6-formyl-2,3-dimethoxybenzoic acid |
MF | C10H10O5 |
Berat Molekul | 210.1834 |
InChI | InChI=1/C10H10O5/c1-14-7-4-3-6(5-11)8(10(12)13)9(7)15-2/h3-5H,1-2H3,(H,12,13) |
CAS NO | 519-05-1 |
EINECS | 208-261-4 |
Struktur Molekul | ![]() |
Kepadatan | 1.3g/cm3 |
Titik didih | 386.3°C at 760 mmHg |
Indeks bias | 1.573 |
Titik nyala | 155.1°C |
Tekanan uap | 1.17E-06mmHg at 25°C |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |