ChemIndex - Basis data CAS kimia gratisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
tetraiodoethylene |
|
Nama produk | tetraiodoethylene |
Nama bahasa Inggris | tetraiodoethylene;diiodoform;tetraiodoethene |
MF | C2I4 |
Berat Molekul | 531.6393 |
InChI | InChI=1/C2I4/c3-1(4)2(5)6 |
CAS NO | 513-92-8 |
EINECS | 208-176-2 |
Struktur Molekul | |
Kepadatan | 4.087g/cm3 |
Titik lebur | 191-193℃ |
Titik didih | 288.3°C at 760 mmHg |
Indeks bias | 1.952 |
Titik nyala | 139.9°C |
Tekanan uap | 0.00409mmHg at 25°C |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |