ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
513-86-0 Acetyl methyl carbinol |
|
Nama produk | Acetyl methyl carbinol |
Nama bahasa Inggris | Acetyl methyl carbinol;3-Hydroxy-2-butanone;acetoin, mixture of monomer and dimer;Acetoin (3-Hydroxy-2-butanone);1-acetylethanol;Acetoin;3-hydroxybutan-2-one;(3R)-3-hydroxybutan-2-one;(3S)-3-hydroxybutan-2-one;Acetoion;Acetion |
MF | C4H8O2 |
Berat Molekul | 88.1051 |
InChI | InChI=1/C4H8O2/c1-3(5)4(2)6/h3,5H,1-2H3/t3-/m0/s1 |
CAS NO | 513-86-0 |
EINECS | 208-174-1 |
Struktur Molekul | |
Kepadatan | 0.983g/cm3 |
Titik lebur | 15℃ |
Titik didih | 145.4°C at 760 mmHg |
Indeks bias | 1.408 |
Titik nyala | 49.7°C |
Kelarutan air | SOLUBLE |
Tekanan uap | 1.92mmHg at 25°C |
Simbol bahaya | Xi##Irritant:; |
Kode Risiko | R10||R36/38:; |
Keselamatan Deskripsi | S26||S36/37:; |
MSDS |