ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50-66-8 6-(Methylthio)purine |
|
Nama produk | 6-(Methylthio)purine |
Nama bahasa Inggris | 6-(Methylthio)purine;6-(Methylmercapto)purine;6-(Methylsulfanyl)-9H-purine;6-(methylsulfanyl)-7H-purine;6-(methylsulfanyl)-5H-purine |
MF | C6H6N4S |
Berat Molekul | 166.2036 |
InChI | InChI=1/C6H6N4S/c1-11-6-4-5(8-2-7-4)9-3-10-6/h2-4H,1H3 |
CAS NO | 50-66-8 |
EINECS | 200-057-3 |
Struktur Molekul | ![]() |
Kepadatan | 1.59g/cm3 |
Titik lebur | 221-222℃ |
Titik didih | 290.9°C at 760 mmHg |
Indeks bias | 1.806 |
Titik nyala | 129.7°C |
Tekanan uap | 0.00351mmHg at 25°C |
Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
MSDS |