ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
454-29-5 DL-Homocysteine |
|
Nama produk | DL-Homocysteine |
Nama bahasa Inggris | DL-Homocysteine;DL-Homocysteine 2-Amino-4-mercaptobuyric acid;homocysteine;D-homocysteine |
MF | C4H9NO2S |
Berat Molekul | 135.1848 |
InChI | InChI=1/C4H9NO2S/c5-3(1-2-8)4(6)7/h3,8H,1-2,5H2,(H,6,7)/t3-/m1/s1 |
CAS NO | 454-29-5 |
EINECS | 207-222-9 |
Struktur Molekul | |
Kepadatan | 1.259g/cm3 |
Titik lebur | 232-233℃ |
Titik didih | 299.7°C at 760 mmHg |
Indeks bias | 1.537 |
Titik nyala | 135°C |
Tekanan uap | 0.000278mmHg at 25°C |
Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
MSDS |