ChemIndex - Basis data CAS kimia gratisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1-Chloro-3-fluoro-2-propanol |
|
Nama produk | 1-Chloro-3-fluoro-2-propanol |
Nama bahasa Inggris | 1-Chloro-3-fluoro-2-propanol;1-Chloro-3-fluoroisopropanol;1-chloro-3-fluoropropan-2-ol |
MF | C3H6ClFO |
Berat Molekul | 112.5305 |
InChI | InChI=1/C3H6ClFO/c4-1-3(6)2-5/h3,6H,1-2H2 |
CAS NO | 453-11-2 |
Struktur Molekul | |
Kepadatan | 1.212g/cm3 |
Titik didih | 158.1°C at 760 mmHg |
Indeks bias | 1.399 |
Titik nyala | 49.4°C |
Tekanan uap | 0.951mmHg at 25°C |
Kode Risiko | R10##Flammable.||R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Keselamatan Deskripsi | S23##Do not inhale gas/fumes/vapour/spray.||S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |