ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
452-64-2 1,2-Dimethyl-4-fluorobenzene |
|
Nama produk | 1,2-Dimethyl-4-fluorobenzene |
Nama bahasa Inggris | 1,2-Dimethyl-4-fluorobenzene;Fluoroxylene2;Fluorooxylene;3,4-Dimethylfluorobenzene;4-(Trifluoromethyl)-o-xylene;4-fluoro-1,2-dimethylbenzene;1-fluoro-2,4-dimethylbenzene;4-Fluoro-o-xylene |
MF | C8H9F |
Berat Molekul | 124.1555 |
InChI | InChI=1/C8H9F/c1-6-3-4-8(9)7(2)5-6/h3-5H,1-2H3 |
CAS NO | 452-64-2 |
Struktur Molekul | ![]() |
Kepadatan | 0.984g/cm3 |
Titik didih | 144.62°C at 760 mmHg |
Indeks bias | 1.481 |
Titik nyala | 30.873°C |
Tekanan uap | 6.357mmHg at 25°C |
Simbol bahaya | |
Kode Risiko | R10##Flammable.:; |
Keselamatan Deskripsi | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |