ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
443-33-4 2-Chloro-6-fluorobenzaldoxime |
|
Nama produk | 2-Chloro-6-fluorobenzaldoxime |
Nama bahasa Inggris | 2-Chloro-6-fluorobenzaldoxime;2-Chloro-6-fluorobenzaldehyde oxime |
MF | C7H5ClFNO |
Berat Molekul | 173.5721 |
InChI | InChI=1/C7H5ClFNO/c8-6-2-1-3-7(9)5(6)4-10-11/h1-4,11H |
CAS NO | 443-33-4 |
EINECS | 207-135-6 |
Struktur Molekul | ![]() |
Kepadatan | 1.32g/cm3 |
Titik lebur | 133℃ |
Titik didih | 238°C at 760 mmHg |
Indeks bias | 1.533 |
Titik nyala | 97.8°C |
Tekanan uap | 0.0237mmHg at 25°C |
Simbol bahaya | |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |