ChemIndex - Basis data CAS kimia gratisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
4',5-Dihydroxy-7-methoxyflavone |
|
Nama produk | 4',5-Dihydroxy-7-methoxyflavone |
Nama bahasa Inggris | 4',5-Dihydroxy-7-methoxyflavone;Genkwanin;Gengkwanin |
MF | C16H12O5 |
Berat Molekul | 284.26 |
InChI | InChI=1/C16H12O5/c1-20-11-6-12(18)16-13(19)8-14(21-15(16)7-11)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 |
CAS NO | 437-64-9 |
Struktur Molekul | |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |