Chemindex > 433-53-4
ID ▼
433-53-4 methyl difluoroacetate |
|
| Nama produk | methyl difluoroacetate |
| Nama bahasa Inggris | methyl difluoroacetate;Difluoroacetic acid methyl ester;1,1,2,3,3-pentafluoroprop-1-ene;Methyl 2,2-difluoroacetate |
| MF | C3HF5 |
| Berat Molekul | 132.0321 |
| InChI | InChI=1/C3HF5/c4-1(2(5)6)3(7)8/h2H |
| CAS NO | 433-53-4 |
| EINECS | 207-089-7 |
| Struktur Molekul |  |
| Kepadatan | 1.335g/cm3 |
| Indeks bias | 1.264 |
| Tekanan uap | 2220mmHg at 25°C |
| Kode Risiko | R11##Highly flammable.||R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Keselamatan Deskripsi | S16##Keep away from sources of ignition - No smoking.||S23##Do not inhale gas/fumes/vapour/spray.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- Jika Anda berencana untuk mendapatkan bahan kimia dari China, pergi saja ke mal ChemNet, kami akan mendapatkan harga terbaru dan kompetitif dari produsen China untuk Anda.Silakan kunjungi
ChemNet Mall
Layanan Database CAS Kimia disediakan oleh ChemIndex.com 