ChemIndex - Basis data CAS kimia gratisChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
1-(3-fluorophenyl)ethanol |
|
Nama produk | 1-(3-fluorophenyl)ethanol |
Nama bahasa Inggris | 1-(3-fluorophenyl)ethanol;3-fluorophenyl methyl carbinol;3-Fluoro-alpha-methylbenzyl alcohol~3-Fluorophenyl methyl carbinol;3-Fluoro-α-methylbenzenemethanol |
MF | C8H9FO |
Berat Molekul | 140.1549 |
InChI | InChI=1/C8H9FO/c1-6(10)7-3-2-4-8(9)5-7/h2-6,10H,1H3 |
CAS NO | 402-63-1 |
EINECS | 206-950-4 |
Struktur Molekul | |
Kepadatan | 1.123g/cm3 |
Titik didih | 196.2°C at 760 mmHg |
Indeks bias | 1.51 |
Titik nyala | 90.1°C |
Tekanan uap | 0.251mmHg at 25°C |
Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
MSDS |