ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
39978-14-8 Methyl 3-aminothiophene-4-carboxylate hydrochloride |
|
Nama produk | Methyl 3-aminothiophene-4-carboxylate hydrochloride |
Nama bahasa Inggris | Methyl 3-aminothiophene-4-carboxylate hydrochloride;methyl 4-aminothiophene-3-carboxylate hydrochloride;methyl 4-aminothiophene-3-carboxylate |
MF | C6H7NO2S |
Berat Molekul | 157.1903 |
InChI | InChI=1/C6H7NO2S/c1-9-6(8)4-2-10-3-5(4)7/h2-3H,7H2,1H3 |
CAS NO | 39978-14-8 |
Struktur Molekul | |
Kepadatan | 1.319g/cm3 |
Titik lebur | 203℃ |
Titik didih | 295.9°C at 760 mmHg |
Indeks bias | 1.598 |
Titik nyala | 132.8°C |
Tekanan uap | 0.00148mmHg at 25°C |
Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
MSDS |