ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
35450-36-3 Methyl 2-bromo-5-methoxybenzoate |
|
Nama produk | Methyl 2-bromo-5-methoxybenzoate |
Nama bahasa Inggris | Methyl 2-bromo-5-methoxybenzoate;2-Bromo-5-methoxybenzoic acid methyl ester |
MF | C9H9BrO3 |
Berat Molekul | 245.07 |
InChI | InChI=1/C9H9BrO3/c1-12-6-3-4-8(10)7(5-6)9(11)13-2/h3-5H,1-2H3 |
CAS NO | 35450-36-3 |
Struktur Molekul | |
Kepadatan | 1.462g/cm3 |
Titik didih | 291.9°C at 760 mmHg |
Indeks bias | 1.537 |
Titik nyala | 130.4°C |
Tekanan uap | 0.00189mmHg at 25°C |
Simbol bahaya | Xi##Irritant:; |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S24/25##Avoid contact with skin and eyes.:; |
MSDS |