ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
352018-97-4 2- (1,4-diazepan-1-yl) nikotinonitril |
|
Nama produk | 2- (1,4-diazepan-1-yl) nikotinonitril |
Sinonim | 2- (1,4-diazepan-1-yl) piridin-3-karbonitril; |
Nama bahasa Inggris | 2-(1,4-diazepan-1-yl)nicotinonitrile;2-(1,4-diazepan-1-yl)pyridine-3-carbonitrile |
MF | C11H14N4 |
Berat Molekul | 202.2557 |
InChI | InChI=1/C11H14N4/c12-9-10-3-1-5-14-11(10)15-7-2-4-13-6-8-15/h1,3,5,13H,2,4,6-8H2 |
CAS NO | 352018-97-4 |
Struktur Molekul | ![]() |
Kepadatan | 1.18g/cm3 |
Titik didih | 394°C at 760 mmHg |
Indeks bias | 1.592 |
Titik nyala | 192.1°C |
Tekanan uap | 2.05E-06mmHg at 25°C |
Simbol bahaya | |
Kode Risiko | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R34##Causes burns.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |