ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
341-69-5 Orphenadrine hydrochloride |
|
Nama produk | Orphenadrine hydrochloride |
Nama bahasa Inggris | Orphenadrine hydrochloride;N,N-Dimethyl-2-(o-methyl-alpha-phenylbenzyloxy)-ethylamine hydrochloride;N,N-dimethyl-2-[(2-methylphenyl)(phenyl)methoxy]ethanamine hydrochloride (1:1);N,N-dimethyl-2-[(R)-(2-methylphenyl)(phenyl)methoxy]ethanaminium;N,N-dimethyl-2-[(S)-(2-methylphenyl)(phenyl)methoxy]ethanaminium |
MF | C18H24NO |
Berat Molekul | 270.3887 |
InChI | InChI=1/C18H23NO/c1-15-9-7-8-12-17(15)18(20-14-13-19(2)3)16-10-5-4-6-11-16/h4-12,18H,13-14H2,1-3H3/p+1/t18-/m0/s1 |
CAS NO | 341-69-5 |
EINECS | 206-435-4 |
Struktur Molekul | |
Titik lebur | 159-162℃ |
Titik didih | 363°C at 760 mmHg |
Titik nyala | 107.1°C |
Tekanan uap | 1.86E-05mmHg at 25°C |
Simbol bahaya | Xn##Harmful:; |
Kode Risiko | R20/21##Harmful by inhalation and in contact with skin.:; |
Keselamatan Deskripsi | S23##Do not inhale gas/fumes/vapour/spray.:; |
MSDS |