ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
341-02-6 Triphenylcarbenium tetrafluoroborate |
|
Nama produk | Triphenylcarbenium tetrafluoroborate |
Nama bahasa Inggris | Triphenylcarbenium tetrafluoroborate;Trityl fluoroborate;Tritylium tetrafluoroborate;Trityl tetrafluoroborate;triphenylmethylium tetrafluoroborate |
MF | C19H15BF4 |
Berat Molekul | 330.127 |
InChI | InChI=1/C19H15.BF4/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;2-1(3,4)5/h1-15H;/q+1;-1 |
CAS NO | 341-02-6 |
EINECS | 206-433-3 |
Struktur Molekul | |
Titik lebur | 205-215℃ |
Simbol bahaya | C##Corrosive:; |
Kode Risiko | R34##Causes burns.:; |
Keselamatan Deskripsi | S25##Avoid contact with eyes.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |