ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
339-59-3 4-(Trifluoromethyl)benzhydrazide |
|
Nama produk | 4-(Trifluoromethyl)benzhydrazide |
Nama bahasa Inggris | 4-(Trifluoromethyl)benzhydrazide;4-(Trifluoromethyl)benzohydrazide;TIMTEC-BB SBB001890;4-(TRIFLUOROMETHYL)BENZOIC ACID HYDRAZIDE;4-(TRIFLUOROMETHYL)BENZENE-1-CARBOHYDRAZIDE;ALPHA,ALPHA,ALPHA-TRIFLUORO-P-TOLUIC ACID HYDRAZIDE;AKOS BBS-00001991;BUTTPARK 30\01-48;ethyl N-(3-chloro-4-fluorophenyl)-N-(phenylcarbonyl)alaninate;4-(Trifluoromethyl)-benzoic acid hydrazide |
MF | C18H17ClFNO3 |
Berat Molekul | 349.7839 |
InChI | InChI=1/C18H17ClFNO3/c1-3-24-18(23)12(2)21(14-9-10-16(20)15(19)11-14)17(22)13-7-5-4-6-8-13/h4-12H,3H2,1-2H3 |
CAS NO | 339-59-3 |
Struktur Molekul | |
Kepadatan | 1.281g/cm3 |
Titik lebur | 115-119℃ |
Titik didih | 470.6°C at 760 mmHg |
Indeks bias | 1.578 |
Titik nyala | 238.4°C |
Tekanan uap | 5.01E-09mmHg at 25°C |
Simbol bahaya | Xi##Irritant:; |
Kode Risiko | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |