ChemIndex - Basis data CAS kimia gratisToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
33305-08-7 methyl 1,3-thiazolane-2-carboxylate hydrochloride |
|
Nama produk | methyl 1,3-thiazolane-2-carboxylate hydrochloride |
Nama bahasa Inggris | methyl 1,3-thiazolane-2-carboxylate hydrochloride;methyl 1,3-thiazolidine-2-carboxylate hydrochloride |
MF | C5H10ClNO2S |
Berat Molekul | 183.6564 |
InChI | InChI=1/C5H9NO2S.ClH/c1-8-5(7)4-6-2-3-9-4;/h4,6H,2-3H2,1H3;1H |
CAS NO | 33305-08-7 |
EINECS | 256-726-5 |
Struktur Molekul | |
Titik lebur | 159-163℃ (dec.) |
Titik didih | 238.9°C at 760 mmHg |
Titik nyala | 98.3°C |
Tekanan uap | 0.0413mmHg at 25°C |
Simbol bahaya | Xn##Harmful:; |
Kode Risiko | R22##Harmful if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Keselamatan Deskripsi | S22||S24/25:; |
MSDS |